C10H14FN3S — CID 115750149
5-fluoro-N-(thian-4-ylmethyl)pyrimidin-2-amine (PubChem CID 115750149) has the molecular formula C10H14FN3S and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-fluoro-N-(thian-4-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(thian-4-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115750149 |
| Molecular Formula | C10H14FN3S |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 5-fluoro-N-(thian-4-ylmethyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(NCC2CCSCC2)nc1 |
| InChI | InChI=1S/C10H14FN3S/c11-9-6-13-10(14-7-9)12-5-8-1-3-15-4-2-8/h6-8H,1-5H2,(H,12,13,14) |
| InChIKey | OMDHMNVEFYLWLP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |