C14H21FN4 — CID 122569805
N-[[1-(cyclopropylmethyl)piperidin-4-yl]methyl]-5-fluoropyrimidin-2-amine (PubChem CID 122569805) has the molecular formula C14H21FN4 and a molecular weight of 264.35 g/mol. Its IUPAC name is N-[[1-(cyclopropylmethyl)piperidin-4-yl]methyl]-5-fluoropyrimidin-2-amine.
| Compound Name | N-[[1-(cyclopropylmethyl)piperidin-4-yl]methyl]-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 122569805 |
| Molecular Formula | C14H21FN4 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-[[1-(cyclopropylmethyl)piperidin-4-yl]methyl]-5-fluoropyrimidin-2-amine |
| SMILES | Fc1cnc(NCC2CCN(CC3CC3)CC2)nc1 |
| InChI | InChI=1S/C14H21FN4/c15-13-8-17-14(18-9-13)16-7-11-3-5-19(6-4-11)10-12-1-2-12/h8-9,11-12H,1-7,10H2,(H,16,17,18) |
| InChIKey | YLXUVOCCJTVUAT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |