C24H35N5O — CID 11575104
N-[2-(4-cyclopentylpiperazin-1-yl)-4-pyridinyl]-3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carboxamide (PubChem CID 11575104) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is N-[2-(4-cyclopentylpiperazin-1-yl)-4-pyridinyl]-3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[2-(4-cyclopentylpiperazin-1-yl)-4-pyridinyl]-3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 11575104 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | N-[2-(4-cyclopentylpiperazin-1-yl)-4-pyridinyl]-3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(Nc1ccnc(N2CCN(C3CCCC3)CC2)c1)N1CCC2CCCC=C2C1 |
| InChI | InChI=1S/C24H35N5O/c30-24(29-12-10-19-5-1-2-6-20(19)18-29)26-21-9-11-25-23(17-21)28-15-13-27(14-16-28)22-7-3-4-8-22/h6,9,11,17,19,22H,1-5,7-8,10,12-16,18H2,(H,25,26,30) |
| InChIKey | VOVZUGGJNKMMNU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|