C12H23N — CID 115755990
N-but-3-en-2-yl-3,5-dimethylcyclohexan-1-amine (PubChem CID 115755990) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-but-3-en-2-yl-3,5-dimethylcyclohexan-1-amine.
| Compound Name | N-but-3-en-2-yl-3,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 115755990 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-but-3-en-2-yl-3,5-dimethylcyclohexan-1-amine |
| SMILES | C=CC(C)NC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C12H23N/c1-5-11(4)13-12-7-9(2)6-10(3)8-12/h5,9-13H,1,6-8H2,2-4H3 |
| InChIKey | XTKOCGZRCPSNKV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|