C11H19NO3S2 — CID 115756286
N-(3-hydroxybutyl)-N,2,5-trimethylthiophene-3-sulfonamide (PubChem CID 115756286) has the molecular formula C11H19NO3S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-N,2,5-trimethylthiophene-3-sulfonamide.
| Compound Name | N-(3-hydroxybutyl)-N,2,5-trimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115756286 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-(3-hydroxybutyl)-N,2,5-trimethylthiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCC(C)O)c(C)s1 |
| InChI | InChI=1S/C11H19NO3S2/c1-8(13)5-6-12(4)17(14,15)11-7-9(2)16-10(11)3/h7-8,13H,5-6H2,1-4H3 |
| InChIKey | DOGMWVLKAQYBDZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |