C13H16N2O2S2 — CID 47020938
N,2,5-trimethyl-N-(pyridin-4-ylmethyl)thiophene-3-sulfonamide (PubChem CID 47020938) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N,2,5-trimethyl-N-(pyridin-4-ylmethyl)thiophene-3-sulfonamide.
| Compound Name | N,2,5-trimethyl-N-(pyridin-4-ylmethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 47020938 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N,2,5-trimethyl-N-(pyridin-4-ylmethyl)thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)Cc2ccncc2)c(C)s1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-10-8-13(11(2)18-10)19(16,17)15(3)9-12-4-6-14-7-5-12/h4-8H,9H2,1-3H3 |
| InChIKey | ZJBLYULEUUPHJD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |