C23H22N6O4 — CID 11575929
N-(1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl)-2-(10-oxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl)acetamide (PubChem CID 11575929) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is N-(1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl)-2-(10-oxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl)acetamide.
| Compound Name | N-(1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl)-2-(10-oxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl)acetamide |
|---|---|
| PubChem CID | 11575929 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-(1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl)-2-(10-oxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-3-yl)acetamide |
| SMILES | CN1C(=O)NC(=O)C12Cc1ccc(NC(=O)CN3CN4CC(=O)Nc5cccc3c54)cc1C2 |
| InChI | InChI=1S/C23H22N6O4/c1-27-22(33)26-21(32)23(27)8-13-5-6-15(7-14(13)9-23)24-18(30)10-28-12-29-11-19(31)25-16-3-2-4-17(28)20(16)29/h2-7H,8-12H2,1H3,(H,24,30)(H,25,31)(H,26,32,33) |
| InChIKey | VUWSJHAQMMMHSR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|