C26H30N4O4S — CID 25144228
2-[(6S)-3,3-dimethyl-6-(3-methylthiophen-2-yl)-2-oxopiperidin-1-yl]-N-(1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl)acetamide (PubChem CID 25144228) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-[(6S)-3,3-dimethyl-6-(3-methylthiophen-2-yl)-2-oxopiperidin-1-yl]-N-(1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl)acetamide.
| Compound Name | 2-[(6S)-3,3-dimethyl-6-(3-methylthiophen-2-yl)-2-oxopiperidin-1-yl]-N-(1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl)acetamide |
|---|---|
| PubChem CID | 25144228 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-[(6S)-3,3-dimethyl-6-(3-methylthiophen-2-yl)-2-oxopiperidin-1-yl]-N-(1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl)acetamide |
| SMILES | Cc1ccsc1[C@@H]1CCC(C)(C)C(=O)N1CC(=O)Nc1ccc2c(c1)CC1(C2)C(=O)NC(=O)N1C |
| InChI | InChI=1S/C26H30N4O4S/c1-15-8-10-35-21(15)19-7-9-25(2,3)23(33)30(19)14-20(31)27-18-6-5-16-12-26(13-17(16)11-18)22(32)28-24(34)29(26)4/h5-6,8,10-11,19H,7,9,12-14H2,1-4H3,(H,27,31)(H,28,32,34)/t19-,26?/m0/s1 |
| InChIKey | JAAAAHYSOHTDHK-SXMXNQBWSA-N |
| XLogP | 3.40 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|