C26H28F2N4O5S — CID 89221422
2-[(5S)-5-[(1E,3E)-3,5-difluorohexa-1,3,5-trienyl]-2,2-dimethyl-1,3-dioxo-1,4-thiazinan-4-yl]-N-[(2S)-1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl]acetamide (PubChem CID 89221422) has the molecular formula C26H28F2N4O5S and a molecular weight of 546.60 g/mol. Its IUPAC name is 2-[(5S)-5-[(1E,3E)-3,5-difluorohexa-1,3,5-trienyl]-2,2-dimethyl-1,3-dioxo-1,4-thiazinan-4-yl]-N-[(2S)-1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl]acetamide.
| Compound Name | 2-[(5S)-5-[(1E,3E)-3,5-difluorohexa-1,3,5-trienyl]-2,2-dimethyl-1,3-dioxo-1,4-thiazinan-4-yl]-N-[(2S)-1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl]acetamide |
|---|---|
| PubChem CID | 89221422 |
| Molecular Formula | C26H28F2N4O5S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 2-[(5S)-5-[(1E,3E)-3,5-difluorohexa-1,3,5-trienyl]-2,2-dimethyl-1,3-dioxo-1,4-thiazinan-4-yl]-N-[(2S)-1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl]acetamide |
| SMILES | C=C(F)/C=C(F)\C=C\[C@H]1CS(=O)C(C)(C)C(=O)N1CC(=O)Nc1ccc2c(c1)C[C@@]1(C2)C(=O)NC(=O)N1C |
| InChI | InChI=1S/C26H28F2N4O5S/c1-15(27)9-18(28)6-8-20-14-38(37)25(2,3)23(35)32(20)13-21(33)29-19-7-5-16-11-26(12-17(16)10-19)22(34)30-24(36)31(26)4/h5-10,20H,1,11-14H2,2-4H3,(H,29,33)(H,30,34,36)/b8-6+,18-9+/t20-,26-,38?/m0/s1 |
| InChIKey | FEGWYIFECZZPMV-VHVCSXDMSA-N |
| XLogP | 2.28 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|