C19H22ClF3N4O3 — CID 11575936
[1-[[2-(3-chloroanilino)-4-(trifluoromethyl)pyrimidin-5-yl]methyl]piperidin-4-yl]methanol;formic acid (PubChem CID 11575936) has the molecular formula C19H22ClF3N4O3 and a molecular weight of 446.86 g/mol. Its IUPAC name is [1-[[2-(3-chloroanilino)-4-(trifluoromethyl)pyrimidin-5-yl]methyl]piperidin-4-yl]methanol;formic acid.
| Compound Name | [1-[[2-(3-chloroanilino)-4-(trifluoromethyl)pyrimidin-5-yl]methyl]piperidin-4-yl]methanol;formic acid |
|---|---|
| PubChem CID | 11575936 |
| Molecular Formula | C19H22ClF3N4O3 |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [1-[[2-(3-chloroanilino)-4-(trifluoromethyl)pyrimidin-5-yl]methyl]piperidin-4-yl]methanol;formic acid |
| SMILES | O=CO.OCC1CCN(Cc2cnc(Nc3cccc(Cl)c3)nc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H20ClF3N4O.CH2O2/c19-14-2-1-3-15(8-14)24-17-23-9-13(16(25-17)18(20,21)22)10-26-6-4-12(11-27)5-7-26;2-1-3/h1-3,8-9,12,27H,4-7,10-11H2,(H,23,24,25);1H,(H,2,3) |
| InChIKey | AENXTTLACCAIIV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|