C15H19ClINO3 — CID 115759730
5-chloro-N-[(1-hydroxycyclopentyl)methyl]-4-iodo-2-methoxy-N-methylbenzamide (PubChem CID 115759730) has the molecular formula C15H19ClINO3 and a molecular weight of 423.68 g/mol. Its IUPAC name is 5-chloro-N-[(1-hydroxycyclopentyl)methyl]-4-iodo-2-methoxy-N-methylbenzamide.
| Compound Name | 5-chloro-N-[(1-hydroxycyclopentyl)methyl]-4-iodo-2-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 115759730 |
| Molecular Formula | C15H19ClINO3 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 5-chloro-N-[(1-hydroxycyclopentyl)methyl]-4-iodo-2-methoxy-N-methylbenzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)N(C)CC1(O)CCCC1 |
| InChI | InChI=1S/C15H19ClINO3/c1-18(9-15(20)5-3-4-6-15)14(19)10-7-11(16)12(17)8-13(10)21-2/h7-8,20H,3-6,9H2,1-2H3 |
| InChIKey | YDKFZCYZQRHGCB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|