C14H18N4O2 — CID 115759787
N-[(1-hydroxycyclopentyl)methyl]-N-methyl-2H-benzotriazole-5-carboxamide (PubChem CID 115759787) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[(1-hydroxycyclopentyl)methyl]-N-methyl-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[(1-hydroxycyclopentyl)methyl]-N-methyl-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 115759787 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-[(1-hydroxycyclopentyl)methyl]-N-methyl-2H-benzotriazole-5-carboxamide |
| SMILES | CN(CC1(O)CCCC1)C(=O)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C14H18N4O2/c1-18(9-14(20)6-2-3-7-14)13(19)10-4-5-11-12(8-10)16-17-15-11/h4-5,8,20H,2-3,6-7,9H2,1H3,(H,15,16,17) |
| InChIKey | FHGDOKBWOYPLML-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |