C13H12N4OS — CID 18126143
N-methyl-N-(thiophen-3-ylmethyl)-2H-benzotriazole-5-carboxamide (PubChem CID 18126143) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is N-methyl-N-(thiophen-3-ylmethyl)-2H-benzotriazole-5-carboxamide.
| Compound Name | N-methyl-N-(thiophen-3-ylmethyl)-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 18126143 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-methyl-N-(thiophen-3-ylmethyl)-2H-benzotriazole-5-carboxamide |
| SMILES | CN(Cc1ccsc1)C(=O)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C13H12N4OS/c1-17(7-9-4-5-19-8-9)13(18)10-2-3-11-12(6-10)15-16-14-11/h2-6,8H,7H2,1H3,(H,14,15,16) |
| InChIKey | UZLQHDIPNKWCEN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |