C14H15NO3S2 — CID 18117252
N-methyl-3-methylsulfonyl-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 18117252) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-methyl-3-methylsulfonyl-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | N-methyl-3-methylsulfonyl-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18117252 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-methyl-3-methylsulfonyl-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | CN(Cc1ccsc1)C(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H15NO3S2/c1-15(9-11-6-7-19-10-11)14(16)12-4-3-5-13(8-12)20(2,17)18/h3-8,10H,9H2,1-2H3 |
| InChIKey | GMCSDDIXZTYZFH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |