C20H19FN2O3S2 — CID 18117406
3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-methyl-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 18117406) has the molecular formula C20H19FN2O3S2 and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-methyl-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-methyl-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18117406 |
| Molecular Formula | C20H19FN2O3S2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-methyl-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)N(C)Cc3ccsc3)c2)cc1F |
| InChI | InChI=1S/C20H19FN2O3S2/c1-14-6-7-18(11-19(14)21)28(25,26)22-17-5-3-4-16(10-17)20(24)23(2)12-15-8-9-27-13-15/h3-11,13,22H,12H2,1-2H3 |
| InChIKey | FDGIVBNSDPPZGJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |