C20H19FN4O3S — CID 55370274
N,N-bis(2-cyanoethyl)-3-[(3-fluoro-4-methylphenyl)sulfonylamino]benzamide (PubChem CID 55370274) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-3-[(3-fluoro-4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N,N-bis(2-cyanoethyl)-3-[(3-fluoro-4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 55370274 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-3-[(3-fluoro-4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)N(CCC#N)CCC#N)c2)cc1F |
| InChI | InChI=1S/C20H19FN4O3S/c1-15-7-8-18(14-19(15)21)29(27,28)24-17-6-2-5-16(13-17)20(26)25(11-3-9-22)12-4-10-23/h2,5-8,13-14,24H,3-4,11-12H2,1H3 |
| InChIKey | CIVHOFJQYOADKT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |