C15H13ClFNO — CID 115762404
N-[(5-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 115762404) has the molecular formula C15H13ClFNO and a molecular weight of 277.73 g/mol. Its IUPAC name is N-[(5-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-[(5-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 115762404 |
| Molecular Formula | C15H13ClFNO |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[(5-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | Fc1ccc(Cl)cc1CNc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H13ClFNO/c16-12-1-3-14(17)11(7-12)9-18-13-2-4-15-10(8-13)5-6-19-15/h1-4,7-8,18H,5-6,9H2 |
| InChIKey | DTRZMNIKKCMJLZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|