C16H13FN2O — CID 103756683
5-[(2,3-dihydro-1-benzofuran-5-ylamino)methyl]-2-fluorobenzonitrile (PubChem CID 103756683) has the molecular formula C16H13FN2O and a molecular weight of 268.29 g/mol. Its IUPAC name is 5-[(2,3-dihydro-1-benzofuran-5-ylamino)methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2,3-dihydro-1-benzofuran-5-ylamino)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 103756683 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-[(2,3-dihydro-1-benzofuran-5-ylamino)methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CNc2ccc3c(c2)CCO3)ccc1F |
| InChI | InChI=1S/C16H13FN2O/c17-15-3-1-11(7-13(15)9-18)10-19-14-2-4-16-12(8-14)5-6-20-16/h1-4,7-8,19H,5-6,10H2 |
| InChIKey | CQKWRPKRYSFVOQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|