About (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate
(2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate (PubChem CID 11576262) has the molecular formula C23H25Cl2N3O3
and a molecular weight of 462.38 g/mol. Its IUPAC name is (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate.
Molecular Properties
| Compound Name | (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate |
| PubChem CID | 11576262 |
| Molecular Formula | C23H25Cl2N3O3 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate |
| SMILES | CC(C)(CN1CCOCC1)OC(=O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C23H25Cl2N3O3/c1-23(2,15-27-9-11-30-12-10-27)31-22(29)21-18-5-3-4-6-20(18)28(26-21)14-16-7-8-17(24)13-19(16)25/h3-8,13H,9-12,14-15H2,1-2H3 |
| InChIKey | ATFQZNJHQFPJQI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate?
The IUPAC name of (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate (CID 11576262) is (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate.
What is the SMILES notation for (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate?
The canonical SMILES for (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate is CC(C)(CN1CCOCC1)OC(=O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12.
What is the InChIKey of (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate?
The InChIKey is ATFQZNJHQFPJQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25Cl2N3O3/c1-23(2,15-27-9-11-30-12-10-27)31-22(29)21-18-5-3-4-6-20(18)28(26-21)14-16-7-8-17(24)13-19(16)25/h3-8,13H,9-12,14-15H2,1-2H3.
What are the key properties of (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate?
(2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate has a molecular weight of 462.38 g/mol, XLogP of 4.66, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1-morpholin-4-ylpropan-2-yl) 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylate is sourced from PubChem (CID 11576262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).