C14H20N4O2 — CID 115762828
N-[(2-ethylpyrazol-3-yl)methyl]-6-(2-methoxyethoxy)pyridin-3-amine (PubChem CID 115762828) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)methyl]-6-(2-methoxyethoxy)pyridin-3-amine.
| Compound Name | N-[(2-ethylpyrazol-3-yl)methyl]-6-(2-methoxyethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 115762828 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)methyl]-6-(2-methoxyethoxy)pyridin-3-amine |
| SMILES | CCn1nccc1CNc1ccc(OCCOC)nc1 |
| InChI | InChI=1S/C14H20N4O2/c1-3-18-13(6-7-17-18)11-15-12-4-5-14(16-10-12)20-9-8-19-2/h4-7,10,15H,3,8-9,11H2,1-2H3 |
| InChIKey | BFTLIHMZQOUNHD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|