C13H16N2S — CID 115762936
5-[[2-(cyclopenten-1-yl)ethylamino]methyl]thiophene-3-carbonitrile (PubChem CID 115762936) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 5-[[2-(cyclopenten-1-yl)ethylamino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[2-(cyclopenten-1-yl)ethylamino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 115762936 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-[[2-(cyclopenten-1-yl)ethylamino]methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNCCC2=CCCC2)c1 |
| InChI | InChI=1S/C13H16N2S/c14-8-12-7-13(16-10-12)9-15-6-5-11-3-1-2-4-11/h3,7,10,15H,1-2,4-6,9H2 |
| InChIKey | YRNBXDYOHKNCDP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|