C10H11N5S — CID 79613378
5-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]thiophene-3-carbonitrile (PubChem CID 79613378) has the molecular formula C10H11N5S and a molecular weight of 233.30 g/mol. Its IUPAC name is 5-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79613378 |
| Molecular Formula | C10H11N5S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNCCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C10H11N5S/c11-4-8-3-9(16-6-8)5-12-2-1-10-13-7-14-15-10/h3,6-7,12H,1-2,5H2,(H,13,14,15) |
| InChIKey | VEBVECONINAUDP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|