C13H19NOS — CID 115763792
2-(3,6-dihydro-2H-pyran-4-yl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 115763792) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-4-yl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | 2-(3,6-dihydro-2H-pyran-4-yl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115763792 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-4-yl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | Cc1ccsc1CNCCC1=CCOCC1 |
| InChI | InChI=1S/C13H19NOS/c1-11-5-9-16-13(11)10-14-6-2-12-3-7-15-8-4-12/h3,5,9,14H,2,4,6-8,10H2,1H3 |
| InChIKey | WQNLXUDIUWVPIU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|