C8H12BrN3OS — CID 115764259
5-bromo-N-(2-methylsulfinylpropyl)pyrimidin-4-amine (PubChem CID 115764259) has the molecular formula C8H12BrN3OS and a molecular weight of 278.18 g/mol. Its IUPAC name is 5-bromo-N-(2-methylsulfinylpropyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-N-(2-methylsulfinylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115764259 |
| Molecular Formula | C8H12BrN3OS |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 5-bromo-N-(2-methylsulfinylpropyl)pyrimidin-4-amine |
| SMILES | CC(CNc1ncncc1Br)S(C)=O |
| InChI | InChI=1S/C8H12BrN3OS/c1-6(14(2)13)3-11-8-7(9)4-10-5-12-8/h4-6H,3H2,1-2H3,(H,10,11,12) |
| InChIKey | RAVWJRSOEXVJQB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |