C17H21ClN2O — CID 115764370
N-[(5-chloroquinolin-8-yl)methyl]-2,2-dimethyloxan-4-amine (PubChem CID 115764370) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-[(5-chloroquinolin-8-yl)methyl]-2,2-dimethyloxan-4-amine.
| Compound Name | N-[(5-chloroquinolin-8-yl)methyl]-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 115764370 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[(5-chloroquinolin-8-yl)methyl]-2,2-dimethyloxan-4-amine |
| SMILES | CC1(C)CC(NCc2ccc(Cl)c3cccnc23)CCO1 |
| InChI | InChI=1S/C17H21ClN2O/c1-17(2)10-13(7-9-21-17)20-11-12-5-6-15(18)14-4-3-8-19-16(12)14/h3-6,8,13,20H,7,9-11H2,1-2H3 |
| InChIKey | XPXKGYRSKSTUNT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |