C10H15NO2 — CID 115764739
N-[1-(hydroxymethyl)cyclopropyl]cyclopent-3-ene-1-carboxamide (PubChem CID 115764739) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclopropyl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[1-(hydroxymethyl)cyclopropyl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 115764739 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclopropyl]cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(NC1(CO)CC1)C1CC=CC1 |
| InChI | InChI=1S/C10H15NO2/c12-7-10(5-6-10)11-9(13)8-3-1-2-4-8/h1-2,8,12H,3-7H2,(H,11,13) |
| InChIKey | AENMKJPXZOLBMI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|