C9H15NO2 — CID 115878461
N-[1-(hydroxymethyl)cyclobutyl]cyclopropanecarboxamide (PubChem CID 115878461) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclobutyl]cyclopropanecarboxamide.
| Compound Name | N-[1-(hydroxymethyl)cyclobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 115878461 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclobutyl]cyclopropanecarboxamide |
| SMILES | O=C(NC1(CO)CCC1)C1CC1 |
| InChI | InChI=1S/C9H15NO2/c11-6-9(4-1-5-9)10-8(12)7-2-3-7/h7,11H,1-6H2,(H,10,12) |
| InChIKey | MKDVXLQHWHJOSK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |