C22H37NO10 — CID 11576506
tert-butyl (2S)-3-[(2R,3aR,6S,7R,7aR)-6-acetyloxy-7-hydroxy-2-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 11576506) has the molecular formula C22H37NO10 and a molecular weight of 475.54 g/mol. Its IUPAC name is tert-butyl (2S)-3-[(2R,3aR,6S,7R,7aR)-6-acetyloxy-7-hydroxy-2-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-[(2R,3aR,6S,7R,7aR)-6-acetyloxy-7-hydroxy-2-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 11576506 |
| Molecular Formula | C22H37NO10 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | tert-butyl (2S)-3-[(2R,3aR,6S,7R,7aR)-6-acetyloxy-7-hydroxy-2-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(=O)O[C@H]1CO[C@@H]2C[C@@](CO)(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C22H37NO10/c1-12(25)30-15-10-29-14-9-22(11-24,31-17(14)16(15)26)8-13(18(27)32-20(2,3)4)23-19(28)33-21(5,6)7/h13-17,24,26H,8-11H2,1-7H3,(H,23,28)/t13-,14+,15-,16+,17-,22+/m0/s1 |
| InChIKey | UPTJXQUQHHTSCE-TXPCXHQGSA-N |
| XLogP | 0.82 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|