C11H19N3S — CID 115767513
N,N-dimethyl-5-[(2-methylsulfanylethylamino)methyl]pyridin-2-amine (PubChem CID 115767513) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is N,N-dimethyl-5-[(2-methylsulfanylethylamino)methyl]pyridin-2-amine.
| Compound Name | N,N-dimethyl-5-[(2-methylsulfanylethylamino)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115767513 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N,N-dimethyl-5-[(2-methylsulfanylethylamino)methyl]pyridin-2-amine |
| SMILES | CSCCNCc1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C11H19N3S/c1-14(2)11-5-4-10(9-13-11)8-12-6-7-15-3/h4-5,9,12H,6-8H2,1-3H3 |
| InChIKey | AXOOPAQRBYEBLT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|