C11H18FN3 — CID 115768245
5-[(3-fluoropropylamino)methyl]-N,N-dimethylpyridin-2-amine (PubChem CID 115768245) has the molecular formula C11H18FN3 and a molecular weight of 211.28 g/mol. Its IUPAC name is 5-[(3-fluoropropylamino)methyl]-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-[(3-fluoropropylamino)methyl]-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 115768245 |
| Molecular Formula | C11H18FN3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 5-[(3-fluoropropylamino)methyl]-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ccc(CNCCCF)cn1 |
| InChI | InChI=1S/C11H18FN3/c1-15(2)11-5-4-10(9-14-11)8-13-7-3-6-12/h4-5,9,13H,3,6-8H2,1-2H3 |
| InChIKey | TYQYFXRYWDEHOV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|