C12H15Cl2NO — CID 115768729
N-[(2,3-dichlorophenyl)methyl]-3-methyloxolan-3-amine (PubChem CID 115768729) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-3-methyloxolan-3-amine.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-3-methyloxolan-3-amine |
|---|---|
| PubChem CID | 115768729 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-3-methyloxolan-3-amine |
| SMILES | CC1(NCc2cccc(Cl)c2Cl)CCOC1 |
| InChI | InChI=1S/C12H15Cl2NO/c1-12(5-6-16-8-12)15-7-9-3-2-4-10(13)11(9)14/h2-4,15H,5-8H2,1H3 |
| InChIKey | OFYODRZQGKCJII-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |