C10H14BrNOS — CID 131025793
N-[(2-bromothiophen-3-yl)methyl]-3-methyloxolan-3-amine (PubChem CID 131025793) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is N-[(2-bromothiophen-3-yl)methyl]-3-methyloxolan-3-amine.
| Compound Name | N-[(2-bromothiophen-3-yl)methyl]-3-methyloxolan-3-amine |
|---|---|
| PubChem CID | 131025793 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | N-[(2-bromothiophen-3-yl)methyl]-3-methyloxolan-3-amine |
| SMILES | CC1(NCc2ccsc2Br)CCOC1 |
| InChI | InChI=1S/C10H14BrNOS/c1-10(3-4-13-7-10)12-6-8-2-5-14-9(8)11/h2,5,12H,3-4,6-7H2,1H3 |
| InChIKey | KLABRQPGZHBRJI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |