C11H19BrN2OS — CID 115769832
N-[1-(5-bromo-1,3-thiazol-2-yl)ethyl]-4-ethoxybutan-1-amine (PubChem CID 115769832) has the molecular formula C11H19BrN2OS and a molecular weight of 307.26 g/mol. Its IUPAC name is N-[1-(5-bromo-1,3-thiazol-2-yl)ethyl]-4-ethoxybutan-1-amine.
| Compound Name | N-[1-(5-bromo-1,3-thiazol-2-yl)ethyl]-4-ethoxybutan-1-amine |
|---|---|
| PubChem CID | 115769832 |
| Molecular Formula | C11H19BrN2OS |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | N-[1-(5-bromo-1,3-thiazol-2-yl)ethyl]-4-ethoxybutan-1-amine |
| SMILES | CCOCCCCNC(C)c1ncc(Br)s1 |
| InChI | InChI=1S/C11H19BrN2OS/c1-3-15-7-5-4-6-13-9(2)11-14-8-10(12)16-11/h8-9,13H,3-7H2,1-2H3 |
| InChIKey | AVQAKFZSIWZBIJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|