C10H15BrN2S — CID 115890167
(E)-N-[1-(5-bromo-1,3-thiazol-2-yl)ethyl]pent-3-en-1-amine (PubChem CID 115890167) has the molecular formula C10H15BrN2S and a molecular weight of 275.21 g/mol. Its IUPAC name is (E)-N-[1-(5-bromo-1,3-thiazol-2-yl)ethyl]pent-3-en-1-amine.
| Compound Name | (E)-N-[1-(5-bromo-1,3-thiazol-2-yl)ethyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 115890167 |
| Molecular Formula | C10H15BrN2S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (E)-N-[1-(5-bromo-1,3-thiazol-2-yl)ethyl]pent-3-en-1-amine |
| SMILES | C/C=C/CCNC(C)c1ncc(Br)s1 |
| InChI | InChI=1S/C10H15BrN2S/c1-3-4-5-6-12-8(2)10-13-7-9(11)14-10/h3-4,7-8,12H,5-6H2,1-2H3/b4-3+ |
| InChIKey | SSQCGZQTJJJSOO-ONEGZZNKSA-N |
| XLogP | 3.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|