C10H13BrN2S2 — CID 115891542
1-(5-bromo-1,3-thiazol-2-yl)-N-(2-prop-2-ynylsulfanylethyl)ethanamine (PubChem CID 115891542) has the molecular formula C10H13BrN2S2 and a molecular weight of 305.27 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-2-yl)-N-(2-prop-2-ynylsulfanylethyl)ethanamine.
| Compound Name | 1-(5-bromo-1,3-thiazol-2-yl)-N-(2-prop-2-ynylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 115891542 |
| Molecular Formula | C10H13BrN2S2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-2-yl)-N-(2-prop-2-ynylsulfanylethyl)ethanamine |
| SMILES | C#CCSCCNC(C)c1ncc(Br)s1 |
| InChI | InChI=1S/C10H13BrN2S2/c1-3-5-14-6-4-12-8(2)10-13-7-9(11)15-10/h1,7-8,12H,4-6H2,2H3 |
| InChIKey | KOHMIDKISZRHAN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|