C13H15BrFNS — CID 103902539
1-(2-bromo-4-fluorophenyl)-N-(2-prop-2-ynylsulfanylethyl)ethanamine (PubChem CID 103902539) has the molecular formula C13H15BrFNS and a molecular weight of 316.24 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-N-(2-prop-2-ynylsulfanylethyl)ethanamine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-N-(2-prop-2-ynylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 103902539 |
| Molecular Formula | C13H15BrFNS |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-N-(2-prop-2-ynylsulfanylethyl)ethanamine |
| SMILES | C#CCSCCNC(C)c1ccc(F)cc1Br |
| InChI | InChI=1S/C13H15BrFNS/c1-3-7-17-8-6-16-10(2)12-5-4-11(15)9-13(12)14/h1,4-5,9-10,16H,6-8H2,2H3 |
| InChIKey | MHHMZTNOJZJTIO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|