C26H24N4O6S — CID 11577230
(2S)-2-[[2-methoxy-4-[4-[(6-nitro-1,3-benzothiazol-2-yl)amino]phenyl]benzoyl]amino]-3-methylbutanoic acid (PubChem CID 11577230) has the molecular formula C26H24N4O6S and a molecular weight of 520.57 g/mol. Its IUPAC name is (2S)-2-[[2-methoxy-4-[4-[(6-nitro-1,3-benzothiazol-2-yl)amino]phenyl]benzoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-methoxy-4-[4-[(6-nitro-1,3-benzothiazol-2-yl)amino]phenyl]benzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 11577230 |
| Molecular Formula | C26H24N4O6S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | (2S)-2-[[2-methoxy-4-[4-[(6-nitro-1,3-benzothiazol-2-yl)amino]phenyl]benzoyl]amino]-3-methylbutanoic acid |
| SMILES | COc1cc(-c2ccc(Nc3nc4ccc([N+](=O)[O-])cc4s3)cc2)ccc1C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C26H24N4O6S/c1-14(2)23(25(32)33)29-24(31)19-10-6-16(12-21(19)36-3)15-4-7-17(8-5-15)27-26-28-20-11-9-18(30(34)35)13-22(20)37-26/h4-14,23H,1-3H3,(H,27,28)(H,29,31)(H,32,33)/t23-/m0/s1 |
| InChIKey | KXOBRFPKANYBCB-QHCPKHFHSA-N |
| XLogP | 5.46 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|