C13H23N3O5 — CID 115772430
N-(2-hydroxyethyl)-N-(2-methoxyethyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 115772430) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(2-methoxyethyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-(2-hydroxyethyl)-N-(2-methoxyethyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 115772430 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(2-methoxyethyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | COCCN(CCO)C(=O)CCCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C13H23N3O5/c1-14-10-12(19)16(13(14)20)5-3-4-11(18)15(6-8-17)7-9-21-2/h17H,3-10H2,1-2H3 |
| InChIKey | XUUPJMGXECFYKV-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|