C11H14F3N3O2 — CID 115776316
N-(2-hydroxyethyl)-N-prop-2-enyl-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 115776316) has the molecular formula C11H14F3N3O2 and a molecular weight of 277.25 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-prop-2-enyl-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-(2-hydroxyethyl)-N-prop-2-enyl-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 115776316 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-(2-hydroxyethyl)-N-prop-2-enyl-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | C=CCN(CCO)C(=O)Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H14F3N3O2/c1-2-4-16(6-7-18)10(19)8-17-5-3-9(15-17)11(12,13)14/h2-3,5,18H,1,4,6-8H2 |
| InChIKey | AAFJOSIXYQYAKX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|