C9H16N2OS — CID 115777969
2-[1-(2-methyl-1,3-thiazol-5-yl)ethylamino]propan-1-ol (PubChem CID 115777969) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-[1-(2-methyl-1,3-thiazol-5-yl)ethylamino]propan-1-ol.
| Compound Name | 2-[1-(2-methyl-1,3-thiazol-5-yl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 115777969 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[1-(2-methyl-1,3-thiazol-5-yl)ethylamino]propan-1-ol |
| SMILES | Cc1ncc(C(C)NC(C)CO)s1 |
| InChI | InChI=1S/C9H16N2OS/c1-6(5-12)11-7(2)9-4-10-8(3)13-9/h4,6-7,11-12H,5H2,1-3H3 |
| InChIKey | MQMWWNBJHSFVLA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |