C11H18N2S — CID 115890511
N-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]pent-4-en-2-amine (PubChem CID 115890511) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]pent-4-en-2-amine.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 115890511 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]pent-4-en-2-amine |
| SMILES | C=CCC(C)NC(C)c1cnc(C)s1 |
| InChI | InChI=1S/C11H18N2S/c1-5-6-8(2)13-9(3)11-7-12-10(4)14-11/h5,7-9,13H,1,6H2,2-4H3 |
| InChIKey | QDTBXRGVKBETOX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|