C10H12N2OS — CID 176529824
N-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]buta-2,3-dienamide (PubChem CID 176529824) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]buta-2,3-dienamide.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176529824 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-5-yl)ethyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NC(C)c1cnc(C)s1 |
| InChI | InChI=1S/C10H12N2OS/c1-4-5-10(13)12-7(2)9-6-11-8(3)14-9/h5-7H,1H2,2-3H3,(H,12,13) |
| InChIKey | MMIMIKYJMVRZFZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|