C9H10N2OS — CID 104919668
N-but-3-yn-2-yl-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 104919668) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-but-3-yn-2-yl-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 104919668 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | N-but-3-yn-2-yl-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | C#CC(C)NC(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C9H10N2OS/c1-4-6(2)11-9(12)8-5-10-7(3)13-8/h1,5-6H,2-3H3,(H,11,12) |
| InChIKey | SEBYGXDWTVPFMT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|