C14H24N2O — CID 115778877
1-(1,3-diethylpyrazol-5-yl)heptan-2-one (PubChem CID 115778877) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)heptan-2-one.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)heptan-2-one |
|---|---|
| PubChem CID | 115778877 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)heptan-2-one |
| SMILES | CCCCCC(=O)Cc1cc(CC)nn1CC |
| InChI | InChI=1S/C14H24N2O/c1-4-7-8-9-14(17)11-13-10-12(5-2)15-16(13)6-3/h10H,4-9,11H2,1-3H3 |
| InChIKey | QKEGTOOQCMPNDU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|