C15H25N3O2 — CID 116571150
1-(1,3-diethylpyrazol-5-yl)-3-piperidin-4-yloxypropan-2-one (PubChem CID 116571150) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)-3-piperidin-4-yloxypropan-2-one.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)-3-piperidin-4-yloxypropan-2-one |
|---|---|
| PubChem CID | 116571150 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)-3-piperidin-4-yloxypropan-2-one |
| SMILES | CCc1cc(CC(=O)COC2CCNCC2)n(CC)n1 |
| InChI | InChI=1S/C15H25N3O2/c1-3-12-9-13(18(4-2)17-12)10-14(19)11-20-15-5-7-16-8-6-15/h9,15-16H,3-8,10-11H2,1-2H3 |
| InChIKey | RLEBRUUJUHXJBN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |