C36H40N4O5 — CID 11578056
(7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxo-8-[2-(2-phenyl-1H-indol-3-yl)ethylamino]octanoic acid (PubChem CID 11578056) has the molecular formula C36H40N4O5 and a molecular weight of 608.74 g/mol. Its IUPAC name is (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxo-8-[2-(2-phenyl-1H-indol-3-yl)ethylamino]octanoic acid.
| Compound Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxo-8-[2-(2-phenyl-1H-indol-3-yl)ethylamino]octanoic acid |
|---|---|
| PubChem CID | 11578056 |
| Molecular Formula | C36H40N4O5 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxo-8-[2-(2-phenyl-1H-indol-3-yl)ethylamino]octanoic acid |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(=O)O)C(=O)NCCc3c(-c4ccccc4)[nH]c4ccccc34)c2c1 |
| InChI | InChI=1S/C36H40N4O5/c1-23-28(29-21-25(45-2)17-18-31(29)38-23)22-33(41)39-32(15-7-4-8-16-34(42)43)36(44)37-20-19-27-26-13-9-10-14-30(26)40-35(27)24-11-5-3-6-12-24/h3,5-6,9-14,17-18,21,32,38,40H,4,7-8,15-16,19-20,22H2,1-2H3,(H,37,44)(H,39,41)(H,42,43)/t32-/m0/s1 |
| InChIKey | TUBKAIHRCSUYRI-YTTGMZPUSA-N |
| XLogP | 6.05 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|