C32H34F2N2O7S — CID 11578171
(3R,5R)-7-[2,3-bis(4-fluorophenyl)-4-[(2-hydroxyphenyl)sulfamoyl]-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 11578171) has the molecular formula C32H34F2N2O7S and a molecular weight of 628.69 g/mol. Its IUPAC name is (3R,5R)-7-[2,3-bis(4-fluorophenyl)-4-[(2-hydroxyphenyl)sulfamoyl]-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[2,3-bis(4-fluorophenyl)-4-[(2-hydroxyphenyl)sulfamoyl]-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 11578171 |
| Molecular Formula | C32H34F2N2O7S |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | (3R,5R)-7-[2,3-bis(4-fluorophenyl)-4-[(2-hydroxyphenyl)sulfamoyl]-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC(C)c1c(S(=O)(=O)Nc2ccccc2O)c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C32H34F2N2O7S/c1-19(2)30-32(44(42,43)35-26-5-3-4-6-27(26)39)29(20-7-11-22(33)12-8-20)31(21-9-13-23(34)14-10-21)36(30)16-15-24(37)17-25(38)18-28(40)41/h3-14,19,24-25,35,37-39H,15-18H2,1-2H3,(H,40,41)/t24-,25-/m1/s1 |
| InChIKey | GZJKOCTWBFFTJJ-JWQCQUIFSA-N |
| XLogP | 5.71 |
| TPSA | 149.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|