C32H32F4N2O6S — CID 87848649
(3R,5R)-7-[4-[fluoro-(4-fluorophenyl)sulfamoyl]-2,3-bis(4-fluorophenyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 87848649) has the molecular formula C32H32F4N2O6S and a molecular weight of 648.68 g/mol. Its IUPAC name is (3R,5R)-7-[4-[fluoro-(4-fluorophenyl)sulfamoyl]-2,3-bis(4-fluorophenyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[4-[fluoro-(4-fluorophenyl)sulfamoyl]-2,3-bis(4-fluorophenyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 87848649 |
| Molecular Formula | C32H32F4N2O6S |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | (3R,5R)-7-[4-[fluoro-(4-fluorophenyl)sulfamoyl]-2,3-bis(4-fluorophenyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC(C)c1c(S(=O)(=O)N(F)c2ccc(F)cc2)c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C32H32F4N2O6S/c1-19(2)30-32(45(43,44)38(36)25-13-11-24(35)12-14-25)29(20-3-7-22(33)8-4-20)31(21-5-9-23(34)10-6-21)37(30)16-15-26(39)17-27(40)18-28(41)42/h3-14,19,26-27,39-40H,15-18H2,1-2H3,(H,41,42)/t26-,27-/m1/s1 |
| InChIKey | ZHCBJVOJJSYQGF-KAYWLYCHSA-N |
| XLogP | 6.42 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|