C17H24N2O — CID 115782482
4,5,5-trimethyl-1-(1-methylbenzimidazol-2-yl)hexan-2-one (PubChem CID 115782482) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 4,5,5-trimethyl-1-(1-methylbenzimidazol-2-yl)hexan-2-one.
| Compound Name | 4,5,5-trimethyl-1-(1-methylbenzimidazol-2-yl)hexan-2-one |
|---|---|
| PubChem CID | 115782482 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4,5,5-trimethyl-1-(1-methylbenzimidazol-2-yl)hexan-2-one |
| SMILES | CC(CC(=O)Cc1nc2ccccc2n1C)C(C)(C)C |
| InChI | InChI=1S/C17H24N2O/c1-12(17(2,3)4)10-13(20)11-16-18-14-8-6-7-9-15(14)19(16)5/h6-9,12H,10-11H2,1-5H3 |
| InChIKey | NTWKCBDFAOILCU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |