C14H15KN2O3 — CID 58580442
potassium 6-(1-methylbenzimidazol-2-yl)-5-oxohexanoate (PubChem CID 58580442) has the molecular formula C14H15KN2O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is potassium 6-(1-methylbenzimidazol-2-yl)-5-oxohexanoate.
| Compound Name | potassium 6-(1-methylbenzimidazol-2-yl)-5-oxohexanoate |
|---|---|
| PubChem CID | 58580442 |
| Molecular Formula | C14H15KN2O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | potassium 6-(1-methylbenzimidazol-2-yl)-5-oxohexanoate |
| SMILES | Cn1c(CC(=O)CCCC(=O)[O-])nc2ccccc21.[K+] |
| InChI | InChI=1S/C14H16N2O3.K/c1-16-12-7-3-2-6-11(12)15-13(16)9-10(17)5-4-8-14(18)19;/h2-3,6-7H,4-5,8-9H2,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | PQLDZTGHHILMMO-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |